About 4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid
4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid (PubChem CID 22978405) has the molecular formula C21H25N3O3
and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid.
Molecular Properties
| Compound Name | 4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid |
| PubChem CID | 22978405 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid |
| SMILES | [C-]#[N+]c1cc(CC(C)(C)CC(=O)O)ccc1OCCCNc1ccccn1 |
| InChI | InChI=1S/C21H25N3O3/c1-21(2,15-20(25)26)14-16-8-9-18(17(13-16)22-3)27-12-6-11-24-19-7-4-5-10-23-19/h4-5,7-10,13H,6,11-12,14-15H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | JXBGRTOPKXSIFE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 75.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid?
The IUPAC name of 4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid (CID 22978405) is 4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid.
What is the SMILES notation for 4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid?
The canonical SMILES for 4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid is [C-]#[N+]c1cc(CC(C)(C)CC(=O)O)ccc1OCCCNc1ccccn1.
What is the InChIKey of 4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid?
The InChIKey is JXBGRTOPKXSIFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O3/c1-21(2,15-20(25)26)14-16-8-9-18(17(13-16)22-3)27-12-6-11-24-19-7-4-5-10-23-19/h4-5,7-10,13H,6,11-12,14-15H2,1-2H3,(H,23,24)(H,25,26).
What are the key properties of 4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid?
4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid has a molecular weight of 367.45 g/mol, XLogP of 4.56, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-isocyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoic acid is sourced from PubChem (CID 22978405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).