C23H29N3O3 — CID 12018745
ethyl 4-[2-cyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoate (PubChem CID 12018745) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is ethyl 4-[2-cyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 4-[2-cyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 12018745 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | ethyl 4-[2-cyano-4-[3-(pyridin-2-ylamino)propoxy]phenyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)CC(C)(C)Cc1ccc(OCCCNc2ccccn2)cc1C#N |
| InChI | InChI=1S/C23H29N3O3/c1-4-28-22(27)16-23(2,3)15-18-9-10-20(14-19(18)17-24)29-13-7-12-26-21-8-5-6-11-25-21/h5-6,8-11,14H,4,7,12-13,15-16H2,1-3H3,(H,25,26) |
| InChIKey | NRFVFTQGZIDTNA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|