C28H32N2O3 — CID 54315824
ethyl 2-[14-[3-[(4-methyl-2-pyridinyl)amino]propoxy]-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetate (PubChem CID 54315824) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is ethyl 2-[14-[3-[(4-methyl-2-pyridinyl)amino]propoxy]-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetate.
| Compound Name | ethyl 2-[14-[3-[(4-methyl-2-pyridinyl)amino]propoxy]-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetate |
|---|---|
| PubChem CID | 54315824 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | ethyl 2-[14-[3-[(4-methyl-2-pyridinyl)amino]propoxy]-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetate |
| SMILES | CCOC(=O)CC1Cc2ccc(OCCCNc3cc(C)ccn3)cc2Cc2ccccc21 |
| InChI | InChI=1S/C28H32N2O3/c1-3-32-28(31)19-24-16-21-9-10-25(18-23(21)17-22-7-4-5-8-26(22)24)33-14-6-12-29-27-15-20(2)11-13-30-27/h4-5,7-11,13,15,18,24H,3,6,12,14,16-17,19H2,1-2H3,(H,29,30) |
| InChIKey | SOBYGADQFLSOML-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|