C29H34N2O5 — CID 54537881
ethyl 2-[(9S)-14-[3-[(4-ethoxy-1-hydroxy-2-pyridinylidene)amino]propoxy]-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetate (PubChem CID 54537881) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is ethyl 2-[(9S)-14-[3-[(4-ethoxy-1-hydroxy-2-pyridinylidene)amino]propoxy]-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetate.
| Compound Name | ethyl 2-[(9S)-14-[3-[(4-ethoxy-1-hydroxy-2-pyridinylidene)amino]propoxy]-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetate |
|---|---|
| PubChem CID | 54537881 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | ethyl 2-[(9S)-14-[3-[(4-ethoxy-1-hydroxy-2-pyridinylidene)amino]propoxy]-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetate |
| SMILES | CCOC(=O)C[C@@H]1Cc2ccc(OCCC/N=c3/cc(OCC)ccn3O)cc2Cc2ccccc21 |
| InChI | InChI=1S/C29H34N2O5/c1-3-34-26-12-14-31(33)28(20-26)30-13-7-15-36-25-11-10-21-16-24(19-29(32)35-4-2)27-9-6-5-8-22(27)17-23(21)18-25/h5-6,8-12,14,18,20,24,33H,3-4,7,13,15-17,19H2,1-2H3/b30-28-/t24-/m0/s1 |
| InChIKey | IIGVPGLZTAVABY-LKIAPMPTSA-N |
| XLogP | 4.68 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|