C28H32N2O4 — CID 91423593
ethyl 2-[14-[3-[(1-hydroxy-2-pyridinylidene)amino]propoxy]-4-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetate (PubChem CID 91423593) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is ethyl 2-[14-[3-[(1-hydroxy-2-pyridinylidene)amino]propoxy]-4-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetate.
| Compound Name | ethyl 2-[14-[3-[(1-hydroxy-2-pyridinylidene)amino]propoxy]-4-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetate |
|---|---|
| PubChem CID | 91423593 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | ethyl 2-[14-[3-[(1-hydroxy-2-pyridinylidene)amino]propoxy]-4-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaenyl]acetate |
| SMILES | CCOC(=O)CC1Cc2ccc(OCCC/N=c3/ccccn3O)cc2Cc2c(C)cccc21 |
| InChI | InChI=1S/C28H32N2O4/c1-3-33-28(31)19-23-16-21-11-12-24(17-22(21)18-26-20(2)8-6-9-25(23)26)34-15-7-13-29-27-10-4-5-14-30(27)32/h4-6,8-12,14,17,23,32H,3,7,13,15-16,18-19H2,1-2H3/b29-27- |
| InChIKey | UXTMXXFNGNJJIE-OHYPFYFLSA-N |
| XLogP | 4.59 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|