C23H29N3O6S — CID 59904091
ethyl (3S)-3-[[3-[4-[(1-hydroxy-2-pyridinylidene)amino]butoxy]phenyl]sulfonylamino]hex-5-ynoate (PubChem CID 59904091) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is ethyl (3S)-3-[[3-[4-[(1-hydroxy-2-pyridinylidene)amino]butoxy]phenyl]sulfonylamino]hex-5-ynoate.
| Compound Name | ethyl (3S)-3-[[3-[4-[(1-hydroxy-2-pyridinylidene)amino]butoxy]phenyl]sulfonylamino]hex-5-ynoate |
|---|---|
| PubChem CID | 59904091 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | ethyl (3S)-3-[[3-[4-[(1-hydroxy-2-pyridinylidene)amino]butoxy]phenyl]sulfonylamino]hex-5-ynoate |
| SMILES | C#CC[C@@H](CC(=O)OCC)NS(=O)(=O)c1cccc(OCCCC/N=c2\ccccn2O)c1 |
| InChI | InChI=1S/C23H29N3O6S/c1-3-10-19(17-23(27)31-4-2)25-33(29,30)21-12-9-11-20(18-21)32-16-8-6-14-24-22-13-5-7-15-26(22)28/h1,5,7,9,11-13,15,18-19,25,28H,4,6,8,10,14,16-17H2,2H3/b24-22+/t19-/m0/s1 |
| InChIKey | BNYXZTNKPHTODV-DRGFOCDESA-N |
| XLogP | 2.11 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|