C31H35N3O6S — CID 21306339
ethyl 3-[[3-[4-[(1-hydroxy-2-pyridinylidene)amino]butoxy]phenyl]sulfonylamino]-4-naphthalen-2-ylbutanoate (PubChem CID 21306339) has the molecular formula C31H35N3O6S and a molecular weight of 577.70 g/mol. Its IUPAC name is ethyl 3-[[3-[4-[(1-hydroxy-2-pyridinylidene)amino]butoxy]phenyl]sulfonylamino]-4-naphthalen-2-ylbutanoate.
| Compound Name | ethyl 3-[[3-[4-[(1-hydroxy-2-pyridinylidene)amino]butoxy]phenyl]sulfonylamino]-4-naphthalen-2-ylbutanoate |
|---|---|
| PubChem CID | 21306339 |
| Molecular Formula | C31H35N3O6S |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | ethyl 3-[[3-[4-[(1-hydroxy-2-pyridinylidene)amino]butoxy]phenyl]sulfonylamino]-4-naphthalen-2-ylbutanoate |
| SMILES | CCOC(=O)CC(Cc1ccc2ccccc2c1)NS(=O)(=O)c1cccc(OCCCC/N=c2\ccccn2O)c1 |
| InChI | InChI=1S/C31H35N3O6S/c1-2-39-31(35)22-27(21-24-15-16-25-10-3-4-11-26(25)20-24)33-41(37,38)29-13-9-12-28(23-29)40-19-8-6-17-32-30-14-5-7-18-34(30)36/h3-5,7,9-16,18,20,23,27,33,36H,2,6,8,17,19,21-22H2,1H3/b32-30+ |
| InChIKey | VMGLNWPUUAVFOB-NHQGMKOOSA-N |
| XLogP | 4.48 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|