C28H31F3N4O8S — CID 44549760
tert-butyl (2S)-3-[4-[3-[(1-hydroxy-2-pyridinylidene)amino]propoxy]-3-nitrophenyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate (PubChem CID 44549760) has the molecular formula C28H31F3N4O8S and a molecular weight of 640.64 g/mol. Its IUPAC name is tert-butyl (2S)-3-[4-[3-[(1-hydroxy-2-pyridinylidene)amino]propoxy]-3-nitrophenyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate.
| Compound Name | tert-butyl (2S)-3-[4-[3-[(1-hydroxy-2-pyridinylidene)amino]propoxy]-3-nitrophenyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 44549760 |
| Molecular Formula | C28H31F3N4O8S |
| Molecular Weight | 640.64 g/mol |
| Exact Mass | 640.18 |
| IUPAC Name | tert-butyl (2S)-3-[4-[3-[(1-hydroxy-2-pyridinylidene)amino]propoxy]-3-nitrophenyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccc(OCCC/N=c2\ccccn2O)c([N+](=O)[O-])c1)NS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H31F3N4O8S/c1-27(2,3)43-26(36)22(33-44(40,41)21-9-6-8-20(18-21)28(29,30)31)16-19-11-12-24(23(17-19)35(38)39)42-15-7-13-32-25-10-4-5-14-34(25)37/h4-6,8-12,14,17-18,22,33,37H,7,13,15-16H2,1-3H3/b32-25+/t22-/m0/s1 |
| InChIKey | MKTUWUFZLYKFKA-VKCBNVJFSA-N |
| XLogP | 4.25 |
| TPSA | 162.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|