C34H46F3N5O11S — CID 44550012
tert-butyl (2S)-3-[4-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propoxy]-3-nitrophenyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate (PubChem CID 44550012) has the molecular formula C34H46F3N5O11S and a molecular weight of 789.83 g/mol. Its IUPAC name is tert-butyl (2S)-3-[4-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propoxy]-3-nitrophenyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate.
| Compound Name | tert-butyl (2S)-3-[4-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propoxy]-3-nitrophenyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 44550012 |
| Molecular Formula | C34H46F3N5O11S |
| Molecular Weight | 789.83 g/mol |
| Exact Mass | 789.29 |
| IUPAC Name | tert-butyl (2S)-3-[4-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propoxy]-3-nitrophenyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCCOc1ccc(C[C@H](NS(=O)(=O)c2cccc(C(F)(F)F)c2)C(=O)OC(C)(C)C)cc1[N+](=O)[O-])NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H46F3N5O11S/c1-31(2,3)51-27(43)24(41-54(48,49)23-13-10-12-22(20-23)34(35,36)37)18-21-14-15-26(25(19-21)42(46)47)50-17-11-16-38-28(39-29(44)52-32(4,5)6)40-30(45)53-33(7,8)9/h10,12-15,19-20,24,41H,11,16-18H2,1-9H3,(H2,38,39,40,44,45)/t24-/m0/s1 |
| InChIKey | OCDGXPZARNXNNJ-DEOSSOPVSA-N |
| XLogP | 6.02 |
| TPSA | 213.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.83 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|