C38H60N6O10S — CID 22975578
tert-butyl (2S)-2-(benzenesulfonamido)-5-[3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propanoyl]-3,9-diazaspiro[5.5]undecan-9-yl]-5-oxopentanoate (PubChem CID 22975578) has the molecular formula C38H60N6O10S and a molecular weight of 793.00 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzenesulfonamido)-5-[3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propanoyl]-3,9-diazaspiro[5.5]undecan-9-yl]-5-oxopentanoate.
| Compound Name | tert-butyl (2S)-2-(benzenesulfonamido)-5-[3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propanoyl]-3,9-diazaspiro[5.5]undecan-9-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 22975578 |
| Molecular Formula | C38H60N6O10S |
| Molecular Weight | 793.00 g/mol |
| Exact Mass | 792.41 |
| IUPAC Name | tert-butyl (2S)-2-(benzenesulfonamido)-5-[3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]propanoyl]-3,9-diazaspiro[5.5]undecan-9-yl]-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)NC(=NCCC(=O)N1CCC2(CC1)CCN(C(=O)CC[C@H](NS(=O)(=O)c1ccccc1)C(=O)OC(C)(C)C)CC2)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H60N6O10S/c1-35(2,3)52-31(47)28(42-55(50,51)27-13-11-10-12-14-27)15-16-29(45)43-23-18-38(19-24-43)20-25-44(26-21-38)30(46)17-22-39-32(40-33(48)53-36(4,5)6)41-34(49)54-37(7,8)9/h10-14,28,42H,15-26H2,1-9H3,(H2,39,40,41,48,49)/t28-/m0/s1 |
| InChIKey | XDDLOMOVKFNHPK-NDEPHWFRSA-N |
| XLogP | 4.48 |
| TPSA | 202.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.00 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|