C22H22F3N3O8S — CID 3261312
[2-[(3-nitrobenzoyl)amino]-2-oxoethyl] 4-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoate (PubChem CID 3261312) has the molecular formula C22H22F3N3O8S and a molecular weight of 545.49 g/mol. Its IUPAC name is [2-[(3-nitrobenzoyl)amino]-2-oxoethyl] 4-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoate.
| Compound Name | [2-[(3-nitrobenzoyl)amino]-2-oxoethyl] 4-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 3261312 |
| Molecular Formula | C22H22F3N3O8S |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | [2-[(3-nitrobenzoyl)amino]-2-oxoethyl] 4-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoate |
| SMILES | CC(C)CC(NS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)OCC(=O)NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H22F3N3O8S/c1-13(2)9-18(27-37(34,35)17-8-4-6-15(11-17)22(23,24)25)21(31)36-12-19(29)26-20(30)14-5-3-7-16(10-14)28(32)33/h3-8,10-11,13,18,27H,9,12H2,1-2H3,(H,26,29,30) |
| InChIKey | LXIPQBAFLXTDEO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 161.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|