C14H22N2O5S — CID 91477105
[[3-(4-aminobutoxy)phenyl]sulfonylamino] butanoate (PubChem CID 91477105) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is [[3-(4-aminobutoxy)phenyl]sulfonylamino] butanoate.
| Compound Name | [[3-(4-aminobutoxy)phenyl]sulfonylamino] butanoate |
|---|---|
| PubChem CID | 91477105 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | [[3-(4-aminobutoxy)phenyl]sulfonylamino] butanoate |
| SMILES | CCCC(=O)ONS(=O)(=O)c1cccc(OCCCCN)c1 |
| InChI | InChI=1S/C14H22N2O5S/c1-2-6-14(17)21-16-22(18,19)13-8-5-7-12(11-13)20-10-4-3-9-15/h5,7-8,11,16H,2-4,6,9-10,15H2,1H3 |
| InChIKey | NMDNQYPFCAMQCK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|