C22H27N3O4 — CID 151177986
ethyl 2-[3-oxo-8-[3-(pyridin-2-ylamino)propoxy]-1,2,4,5-tetrahydro-1-benzazepin-4-yl]acetate (PubChem CID 151177986) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is ethyl 2-[3-oxo-8-[3-(pyridin-2-ylamino)propoxy]-1,2,4,5-tetrahydro-1-benzazepin-4-yl]acetate.
| Compound Name | ethyl 2-[3-oxo-8-[3-(pyridin-2-ylamino)propoxy]-1,2,4,5-tetrahydro-1-benzazepin-4-yl]acetate |
|---|---|
| PubChem CID | 151177986 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | ethyl 2-[3-oxo-8-[3-(pyridin-2-ylamino)propoxy]-1,2,4,5-tetrahydro-1-benzazepin-4-yl]acetate |
| SMILES | CCOC(=O)CC1Cc2ccc(OCCCNc3ccccn3)cc2NCC1=O |
| InChI | InChI=1S/C22H27N3O4/c1-2-28-22(27)13-17-12-16-7-8-18(14-19(16)25-15-20(17)26)29-11-5-10-24-21-6-3-4-9-23-21/h3-4,6-9,14,17,25H,2,5,10-13,15H2,1H3,(H,23,24) |
| InChIKey | NDRFWXDELZIRNB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|