C31H47N3O3 — CID 139430602
2-[2,2-dimethyl-3-(2,2,4-trimethylpentoxy)propyl]-8-[3-(pyridin-2-ylamino)propoxy]-4,5-dihydro-1H-2-benzazepin-3-one (PubChem CID 139430602) has the molecular formula C31H47N3O3 and a molecular weight of 509.74 g/mol. Its IUPAC name is 2-[2,2-dimethyl-3-(2,2,4-trimethylpentoxy)propyl]-8-[3-(pyridin-2-ylamino)propoxy]-4,5-dihydro-1H-2-benzazepin-3-one.
| Compound Name | 2-[2,2-dimethyl-3-(2,2,4-trimethylpentoxy)propyl]-8-[3-(pyridin-2-ylamino)propoxy]-4,5-dihydro-1H-2-benzazepin-3-one |
|---|---|
| PubChem CID | 139430602 |
| Molecular Formula | C31H47N3O3 |
| Molecular Weight | 509.74 g/mol |
| Exact Mass | 509.36 |
| IUPAC Name | 2-[2,2-dimethyl-3-(2,2,4-trimethylpentoxy)propyl]-8-[3-(pyridin-2-ylamino)propoxy]-4,5-dihydro-1H-2-benzazepin-3-one |
| SMILES | CC(C)CC(C)(C)COCC(C)(C)CN1Cc2cc(OCCCNc3ccccn3)ccc2CCC1=O |
| InChI | InChI=1S/C31H47N3O3/c1-24(2)19-30(3,4)22-36-23-31(5,6)21-34-20-26-18-27(13-11-25(26)12-14-29(34)35)37-17-9-16-33-28-10-7-8-15-32-28/h7-8,10-11,13,15,18,24H,9,12,14,16-17,19-23H2,1-6H3,(H,32,33) |
| InChIKey | UVUTYSIQEWFDSG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.74 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|