C24H30F3N3O4 — CID 143861417
methyl acetate;4-methyl-8-[3-(pyridin-2-ylamino)propoxy]-2-(2,2,2-trifluoroethyl)-4,5-dihydro-1H-2-benzazepin-3-one (PubChem CID 143861417) has the molecular formula C24H30F3N3O4 and a molecular weight of 481.52 g/mol. Its IUPAC name is methyl acetate;4-methyl-8-[3-(pyridin-2-ylamino)propoxy]-2-(2,2,2-trifluoroethyl)-4,5-dihydro-1H-2-benzazepin-3-one.
| Compound Name | methyl acetate;4-methyl-8-[3-(pyridin-2-ylamino)propoxy]-2-(2,2,2-trifluoroethyl)-4,5-dihydro-1H-2-benzazepin-3-one |
|---|---|
| PubChem CID | 143861417 |
| Molecular Formula | C24H30F3N3O4 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | methyl acetate;4-methyl-8-[3-(pyridin-2-ylamino)propoxy]-2-(2,2,2-trifluoroethyl)-4,5-dihydro-1H-2-benzazepin-3-one |
| SMILES | CC1Cc2ccc(OCCCNc3ccccn3)cc2CN(CC(F)(F)F)C1=O.COC(C)=O |
| InChI | InChI=1S/C21H24F3N3O2.C3H6O2/c1-15-11-16-6-7-18(29-10-4-9-26-19-5-2-3-8-25-19)12-17(16)13-27(20(15)28)14-21(22,23)24;1-3(4)5-2/h2-3,5-8,12,15H,4,9-11,13-14H2,1H3,(H,25,26);1-2H3 |
| InChIKey | HZAUVCXPVDVOOI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|