C19H21NO2 — CID 21064777
6,7-dimethyl-1-[(4-nitrophenyl)methyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 21064777) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 6,7-dimethyl-1-[(4-nitrophenyl)methyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6,7-dimethyl-1-[(4-nitrophenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 21064777 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 6,7-dimethyl-1-[(4-nitrophenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1cc2c(cc1C)C(Cc1ccc([N+](=O)[O-])cc1)CCC2 |
| InChI | InChI=1S/C19H21NO2/c1-13-10-16-4-3-5-17(19(16)11-14(13)2)12-15-6-8-18(9-7-15)20(21)22/h6-11,17H,3-5,12H2,1-2H3 |
| InChIKey | WIRULJYLFBKNFH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|