C19H22FN5O3 — CID 21070503
1-[4-amino-3-[[4-(2-fluoro-6-methoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone (PubChem CID 21070503) has the molecular formula C19H22FN5O3 and a molecular weight of 387.42 g/mol. Its IUPAC name is 1-[4-amino-3-[[4-(2-fluoro-6-methoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-amino-3-[[4-(2-fluoro-6-methoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 21070503 |
| Molecular Formula | C19H22FN5O3 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-[4-amino-3-[[4-(2-fluoro-6-methoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]ethanone |
| SMILES | COc1cccc(F)c1C(=O)c1ccnc(NC2CN(C(C)=O)CCC2N)n1 |
| InChI | InChI=1S/C19H22FN5O3/c1-11(26)25-9-7-13(21)15(10-25)24-19-22-8-6-14(23-19)18(27)17-12(20)4-3-5-16(17)28-2/h3-6,8,13,15H,7,9-10,21H2,1-2H3,(H,22,23,24) |
| InChIKey | RLMQHXUHNBPNRX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |