C17H20FIN4O — CID 21071008
1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(4-iodo-3,5-dimethylpyrazol-1-yl)ethanone (PubChem CID 21071008) has the molecular formula C17H20FIN4O and a molecular weight of 442.28 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(4-iodo-3,5-dimethylpyrazol-1-yl)ethanone.
| Compound Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(4-iodo-3,5-dimethylpyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 21071008 |
| Molecular Formula | C17H20FIN4O |
| Molecular Weight | 442.28 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(4-iodo-3,5-dimethylpyrazol-1-yl)ethanone |
| SMILES | Cc1nn(CC(=O)N2CCN(c3ccc(F)cc3)CC2)c(C)c1I |
| InChI | InChI=1S/C17H20FIN4O/c1-12-17(19)13(2)23(20-12)11-16(24)22-9-7-21(8-10-22)15-5-3-14(18)4-6-15/h3-6H,7-11H2,1-2H3 |
| InChIKey | HZHZRUCSCCZSGO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|