C22H31FN4O — CID 70974292
2-(5-butan-2-yl-3-propan-2-ylpyrazol-1-yl)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone (PubChem CID 70974292) has the molecular formula C22H31FN4O and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-(5-butan-2-yl-3-propan-2-ylpyrazol-1-yl)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(5-butan-2-yl-3-propan-2-ylpyrazol-1-yl)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 70974292 |
| Molecular Formula | C22H31FN4O |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 2-(5-butan-2-yl-3-propan-2-ylpyrazol-1-yl)-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone |
| SMILES | CCC(C)c1cc(C(C)C)nn1CC(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H31FN4O/c1-5-17(4)21-14-20(16(2)3)24-27(21)15-22(28)26-12-10-25(11-13-26)19-8-6-18(23)7-9-19/h6-9,14,16-17H,5,10-13,15H2,1-4H3 |
| InChIKey | MKEYDDJIGHYTHE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |