C21H21BFN5O — CID 89153625
CID 89153625 (PubChem CID 89153625) has the molecular formula C21H21BFN5O and a molecular weight of 389.24 g/mol.
| Compound Name | CID 89153625 |
|---|---|
| PubChem CID | 89153625 |
| Molecular Formula | C21H21BFN5O |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | — |
| SMILES | [B]c1c(N)nn(CC(=O)N2CCN(c3ccc(F)cc3)CC2)c1-c1ccccc1 |
| InChI | InChI=1S/C21H21BFN5O/c22-19-20(15-4-2-1-3-5-15)28(25-21(19)24)14-18(29)27-12-10-26(11-13-27)17-8-6-16(23)7-9-17/h1-9H,10-14H2,(H2,24,25) |
| InChIKey | UQPJMARILHFADI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|