C22H16N2O3S — CID 2107162
[2-(naphthalen-1-ylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 2107162) has the molecular formula C22H16N2O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2107162 |
| Molecular Formula | C22H16N2O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1nc2ccccc2s1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C22H16N2O3S/c25-20(23-17-10-5-7-15-6-1-2-8-16(15)17)14-27-22(26)13-12-21-24-18-9-3-4-11-19(18)28-21/h1-13H,14H2,(H,23,25)/b13-12+ |
| InChIKey | XDSWNYBKZFQYME-OUKQBFOZSA-N |
| XLogP | 4.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|