C18H22O4 — CID 21071778
2-(2,2-dimethoxyethoxy)-4-(4-methoxyphenyl)-1-methylbenzene (PubChem CID 21071778) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethoxy)-4-(4-methoxyphenyl)-1-methylbenzene.
| Compound Name | 2-(2,2-dimethoxyethoxy)-4-(4-methoxyphenyl)-1-methylbenzene |
|---|---|
| PubChem CID | 21071778 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-(2,2-dimethoxyethoxy)-4-(4-methoxyphenyl)-1-methylbenzene |
| SMILES | COc1ccc(-c2ccc(C)c(OCC(OC)OC)c2)cc1 |
| InChI | InChI=1S/C18H22O4/c1-13-5-6-15(14-7-9-16(19-2)10-8-14)11-17(13)22-12-18(20-3)21-4/h5-11,18H,12H2,1-4H3 |
| InChIKey | YEBREATYOVNFFT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|