C12H12N2O3S — CID 21077558
5-[(4-methoxyphenyl)methylsulfanyl]-1H-pyrimidine-2,4-dione (PubChem CID 21077558) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methylsulfanyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(4-methoxyphenyl)methylsulfanyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 21077558 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 5-[(4-methoxyphenyl)methylsulfanyl]-1H-pyrimidine-2,4-dione |
| SMILES | COc1ccc(CSc2c[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C12H12N2O3S/c1-17-9-4-2-8(3-5-9)7-18-10-6-13-12(16)14-11(10)15/h2-6H,7H2,1H3,(H2,13,14,15,16) |
| InChIKey | SZOVUZHCCBMJHM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |