C11H10N2O3S — CID 147803297
5-(4-methoxyphenyl)sulfanyl-1H-pyrimidine-2,4-dione (PubChem CID 147803297) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)sulfanyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(4-methoxyphenyl)sulfanyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 147803297 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 5-(4-methoxyphenyl)sulfanyl-1H-pyrimidine-2,4-dione |
| SMILES | COc1ccc(Sc2c[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C11H10N2O3S/c1-16-7-2-4-8(5-3-7)17-9-6-12-11(15)13-10(9)14/h2-6H,1H3,(H2,12,13,14,15) |
| InChIKey | HLXZVXZVEDNNQR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |