C11H11NO3S — CID 91408828
3-(4-methoxyphenyl)sulfanyl-1H-pyrrole-2,5-diol (PubChem CID 91408828) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfanyl-1H-pyrrole-2,5-diol.
| Compound Name | 3-(4-methoxyphenyl)sulfanyl-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91408828 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfanyl-1H-pyrrole-2,5-diol |
| SMILES | COc1ccc(Sc2cc(O)[nH]c2O)cc1 |
| InChI | InChI=1S/C11H11NO3S/c1-15-7-2-4-8(5-3-7)16-9-6-10(13)12-11(9)14/h2-6,12-14H,1H3 |
| InChIKey | MJMMBXUYEBAEFL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |