C14H18N3O6P — CID 46894687
5-[dimethoxyphosphoryl-(4-methoxyanilino)methyl]-1H-pyrimidine-2,4-dione (PubChem CID 46894687) has the molecular formula C14H18N3O6P and a molecular weight of 355.29 g/mol. Its IUPAC name is 5-[dimethoxyphosphoryl-(4-methoxyanilino)methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[dimethoxyphosphoryl-(4-methoxyanilino)methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 46894687 |
| Molecular Formula | C14H18N3O6P |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 5-[dimethoxyphosphoryl-(4-methoxyanilino)methyl]-1H-pyrimidine-2,4-dione |
| SMILES | COc1ccc(NC(c2c[nH]c(=O)[nH]c2=O)P(=O)(OC)OC)cc1 |
| InChI | InChI=1S/C14H18N3O6P/c1-21-10-6-4-9(5-7-10)16-13(24(20,22-2)23-3)11-8-15-14(19)17-12(11)18/h4-8,13,16H,1-3H3,(H2,15,17,18,19) |
| InChIKey | HCDDRJNZTARAKR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|