C12H13N3O6S — CID 7161235
N-(2,4-dimethoxyphenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide (PubChem CID 7161235) has the molecular formula C12H13N3O6S and a molecular weight of 327.32 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 7161235 |
| Molecular Formula | C12H13N3O6S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2c[nH]c(=O)[nH]c2=O)c(OC)c1 |
| InChI | InChI=1S/C12H13N3O6S/c1-20-7-3-4-8(9(5-7)21-2)15-22(18,19)10-6-13-12(17)14-11(10)16/h3-6,15H,1-2H3,(H2,13,14,16,17) |
| InChIKey | LEFFDJGIHLTTQS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |