C30H32N2O5 — CID 21077970
(E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one (PubChem CID 21077970) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one.
| Compound Name | (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 21077970 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one |
| SMILES | O=C(O)/C=C/C(=O)O.O=C1c2ccccc2CN1CC1CCN(CCc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C26H28N2O.C4H4O4/c29-26-25-11-4-2-7-23(25)19-28(26)18-20-12-15-27(16-13-20)17-14-22-9-5-8-21-6-1-3-10-24(21)22;5-3(6)1-2-4(7)8/h1-11,20H,12-19H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ZSJAHPGPBUACFM-WLHGVMLRSA-N |
| XLogP | 4.46 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|