About (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one
(E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one (PubChem CID 21077970) has the molecular formula C30H32N2O5
and a molecular weight of 500.60 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one |
|---|
| PubChem CID | 21077970 |
|---|
| Molecular Formula | C30H32N2O5 |
|---|
| Molecular Weight | 500.60 g/mol |
|---|
| Exact Mass | 500.23 |
|---|
| IUPAC Name | (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one |
|---|
| SMILES | O=C(O)/C=C/C(=O)O.O=C1c2ccccc2CN1CC1CCN(CCc2cccc3ccccc23)CC1 |
|---|
| InChI | InChI=1S/C26H28N2O.C4H4O4/c29-26-25-11-4-2-7-23(25)19-28(26)18-20-12-15-27(16-13-20)17-14-22-9-5-8-21-6-1-3-10-24(21)22;5-3(6)1-2-4(7)8/h1-11,20H,12-19H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
|---|
| InChIKey | ZSJAHPGPBUACFM-WLHGVMLRSA-N |
|---|
| XLogP | 4.46 |
|---|
| TPSA | 98.15 Ų |
|---|
| H-Bond Donors | 2 |
|---|
| H-Bond Acceptors | 4 |
|---|
| Rotatable Bonds | 7 |
|---|
| Heavy Atoms | 37 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
1 violation
| Rule | Value |
|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one?
The IUPAC name of (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one (CID 21077970) is (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one.
What is the SMILES notation for (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one?
The canonical SMILES for (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one is O=C(O)/C=C/C(=O)O.O=C1c2ccccc2CN1CC1CCN(CCc2cccc3ccccc23)CC1.
What is the InChIKey of (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one?
The InChIKey is ZSJAHPGPBUACFM-WLHGVMLRSA-N. The full InChI is InChI=1S/C26H28N2O.C4H4O4/c29-26-25-11-4-2-7-23(25)19-28(26)18-20-12-15-27(16-13-20)17-14-22-9-5-8-21-6-1-3-10-24(21)22;5-3(6)1-2-4(7)8/h1-11,20H,12-19H2;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one?
(E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one has a molecular weight of 500.60 g/mol, XLogP of 4.46, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;2-[[1-(2-naphthalen-1-ylethyl)piperidin-4-yl]methyl]-3H-isoindol-1-one is sourced from PubChem (CID 21077970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).