C26H29FN2O5S — CID 69371267
but-2-enedioic acid;2-[[1-[2-(3-fluorophenyl)sulfanylethyl]piperidin-4-yl]methyl]-3H-isoindol-1-one (PubChem CID 69371267) has the molecular formula C26H29FN2O5S and a molecular weight of 500.59 g/mol. Its IUPAC name is but-2-enedioic acid;2-[[1-[2-(3-fluorophenyl)sulfanylethyl]piperidin-4-yl]methyl]-3H-isoindol-1-one.
| Compound Name | but-2-enedioic acid;2-[[1-[2-(3-fluorophenyl)sulfanylethyl]piperidin-4-yl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 69371267 |
| Molecular Formula | C26H29FN2O5S |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | but-2-enedioic acid;2-[[1-[2-(3-fluorophenyl)sulfanylethyl]piperidin-4-yl]methyl]-3H-isoindol-1-one |
| SMILES | O=C(O)C=CC(=O)O.O=C1c2ccccc2CN1CC1CCN(CCSc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C22H25FN2OS.C4H4O4/c23-19-5-3-6-20(14-19)27-13-12-24-10-8-17(9-11-24)15-25-16-18-4-1-2-7-21(18)22(25)26;5-3(6)1-2-4(7)8/h1-7,14,17H,8-13,15-16H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | FUCZPCPYRQDXCH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|