C27H32N2O6 — CID 69372874
but-2-enedioic acid;2-[[1-[2-(4-methylphenoxy)ethyl]piperidin-4-yl]methyl]-3H-isoindol-1-one (PubChem CID 69372874) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is but-2-enedioic acid;2-[[1-[2-(4-methylphenoxy)ethyl]piperidin-4-yl]methyl]-3H-isoindol-1-one.
| Compound Name | but-2-enedioic acid;2-[[1-[2-(4-methylphenoxy)ethyl]piperidin-4-yl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 69372874 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | but-2-enedioic acid;2-[[1-[2-(4-methylphenoxy)ethyl]piperidin-4-yl]methyl]-3H-isoindol-1-one |
| SMILES | Cc1ccc(OCCN2CCC(CN3Cc4ccccc4C3=O)CC2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H28N2O2.C4H4O4/c1-18-6-8-21(9-7-18)27-15-14-24-12-10-19(11-13-24)16-25-17-20-4-2-3-5-22(20)23(25)26;5-3(6)1-2-4(7)8/h2-9,19H,10-17H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | DANBDJAIINQNLW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|