C18H19NO5 — CID 21079814
2-(3-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 21079814) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | 2-(3-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 21079814 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-(3-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | CCC(NC(=O)OCc1ccccc1)(C(=O)O)c1cccc(O)c1 |
| InChI | InChI=1S/C18H19NO5/c1-2-18(16(21)22,14-9-6-10-15(20)11-14)19-17(23)24-12-13-7-4-3-5-8-13/h3-11,20H,2,12H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | FBQWNIQRHLQOMQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |