C18H10N2 — CID 21082949
4,13-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(18),2(20),3,5,7,9,11(19),12,14,16-decaene (PubChem CID 21082949) has the molecular formula C18H10N2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 4,13-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(18),2(20),3,5,7,9,11(19),12,14,16-decaene.
| Compound Name | 4,13-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(18),2(20),3,5,7,9,11(19),12,14,16-decaene |
|---|---|
| PubChem CID | 21082949 |
| Molecular Formula | C18H10N2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 4,13-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(18),2(20),3,5,7,9,11(19),12,14,16-decaene |
| SMILES | c1cc2cncc3c4cccc5cncc(c(c1)c23)c54 |
| InChI | InChI=1S/C18H10N2/c1-3-11-7-19-10-16-14-6-2-4-12-8-20-9-15(18(12)14)13(5-1)17(11)16/h1-10H |
| InChIKey | MBTIVTWBBBSBNL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|