C24H37N5O4 — CID 21083605
ditert-butyl 2-(4-phenylpiperazin-2-yl)imino-1,3-diazinane-1,3-dicarboxylate (PubChem CID 21083605) has the molecular formula C24H37N5O4 and a molecular weight of 459.59 g/mol. Its IUPAC name is ditert-butyl 2-(4-phenylpiperazin-2-yl)imino-1,3-diazinane-1,3-dicarboxylate.
| Compound Name | ditert-butyl 2-(4-phenylpiperazin-2-yl)imino-1,3-diazinane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 21083605 |
| Molecular Formula | C24H37N5O4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | ditert-butyl 2-(4-phenylpiperazin-2-yl)imino-1,3-diazinane-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(C(=O)OC(C)(C)C)C1=NC1CN(c2ccccc2)CCN1 |
| InChI | InChI=1S/C24H37N5O4/c1-23(2,3)32-21(30)28-14-10-15-29(22(31)33-24(4,5)6)20(28)26-19-17-27(16-13-25-19)18-11-8-7-9-12-18/h7-9,11-12,19,25H,10,13-17H2,1-6H3 |
| InChIKey | PMFUCUQAZJCBGD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|