C21H19NO6S — CID 21084618
(3Z)-1,5-diacetyl-3-[methoxy-(4-methylsulfonylphenyl)methylidene]indol-2-one (PubChem CID 21084618) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is (3Z)-1,5-diacetyl-3-[methoxy-(4-methylsulfonylphenyl)methylidene]indol-2-one.
| Compound Name | (3Z)-1,5-diacetyl-3-[methoxy-(4-methylsulfonylphenyl)methylidene]indol-2-one |
|---|---|
| PubChem CID | 21084618 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | (3Z)-1,5-diacetyl-3-[methoxy-(4-methylsulfonylphenyl)methylidene]indol-2-one |
| SMILES | CO/C(=C1\C(=O)N(C(C)=O)c2ccc(C(C)=O)cc21)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H19NO6S/c1-12(23)15-7-10-18-17(11-15)19(21(25)22(18)13(2)24)20(28-3)14-5-8-16(9-6-14)29(4,26)27/h5-11H,1-4H3/b20-19- |
| InChIKey | NZUQUVBMZHPXGO-VXPUYCOJSA-N |
| XLogP | 2.70 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|