C17H16BrF2N3O3 — CID 21089101
(E)-4-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]-N-methylbut-2-enamide (PubChem CID 21089101) has the molecular formula C17H16BrF2N3O3 and a molecular weight of 428.23 g/mol. Its IUPAC name is (E)-4-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]-N-methylbut-2-enamide.
| Compound Name | (E)-4-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 21089101 |
| Molecular Formula | C17H16BrF2N3O3 |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | (E)-4-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]-N-methylbut-2-enamide |
| SMILES | CNC(=O)/C=C/Cn1c(C)nc(OCc2ccc(F)cc2F)c(Br)c1=O |
| InChI | InChI=1S/C17H16BrF2N3O3/c1-10-22-16(26-9-11-5-6-12(19)8-13(11)20)15(18)17(25)23(10)7-3-4-14(24)21-2/h3-6,8H,7,9H2,1-2H3,(H,21,24)/b4-3+ |
| InChIKey | WLPVRYWTRWKFHC-ONEGZZNKSA-N |
| XLogP | 2.47 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|