C20H16Br2F2N2O2 — CID 21089609
5-bromo-3-[[4-(bromomethyl)phenyl]methyl]-6-[(2,4-difluorophenyl)methoxy]-2-methylpyrimidin-4-one (PubChem CID 21089609) has the molecular formula C20H16Br2F2N2O2 and a molecular weight of 514.16 g/mol. Its IUPAC name is 5-bromo-3-[[4-(bromomethyl)phenyl]methyl]-6-[(2,4-difluorophenyl)methoxy]-2-methylpyrimidin-4-one.
| Compound Name | 5-bromo-3-[[4-(bromomethyl)phenyl]methyl]-6-[(2,4-difluorophenyl)methoxy]-2-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 21089609 |
| Molecular Formula | C20H16Br2F2N2O2 |
| Molecular Weight | 514.16 g/mol |
| Exact Mass | 511.95 |
| IUPAC Name | 5-bromo-3-[[4-(bromomethyl)phenyl]methyl]-6-[(2,4-difluorophenyl)methoxy]-2-methylpyrimidin-4-one |
| SMILES | Cc1nc(OCc2ccc(F)cc2F)c(Br)c(=O)n1Cc1ccc(CBr)cc1 |
| InChI | InChI=1S/C20H16Br2F2N2O2/c1-12-25-19(28-11-15-6-7-16(23)8-17(15)24)18(22)20(27)26(12)10-14-4-2-13(9-21)3-5-14/h2-8H,9-11H2,1H3 |
| InChIKey | PUPMKCUIVXYGHH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.16 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|