C17H15BrF2N2O4 — CID 90941559
methyl 4-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]but-2-enoate (PubChem CID 90941559) has the molecular formula C17H15BrF2N2O4 and a molecular weight of 429.22 g/mol. Its IUPAC name is methyl 4-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]but-2-enoate.
| Compound Name | methyl 4-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 90941559 |
| Molecular Formula | C17H15BrF2N2O4 |
| Molecular Weight | 429.22 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | methyl 4-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxopyrimidin-1-yl]but-2-enoate |
| SMILES | COC(=O)C=CCn1c(C)nc(OCc2ccc(F)cc2F)c(Br)c1=O |
| InChI | InChI=1S/C17H15BrF2N2O4/c1-10-21-16(26-9-11-5-6-12(19)8-13(11)20)15(18)17(24)22(10)7-3-4-14(23)25-2/h3-6,8H,7,9H2,1-2H3 |
| InChIKey | PNLVRSAYJCSWKD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|