C24H24N4O5S — CID 21090562
N'-[3-[4-[[4-(methanesulfonamidomethyl)phenyl]carbamoyl]phenyl]-4-methylphenyl]oxamide (PubChem CID 21090562) has the molecular formula C24H24N4O5S and a molecular weight of 480.55 g/mol. Its IUPAC name is N'-[3-[4-[[4-(methanesulfonamidomethyl)phenyl]carbamoyl]phenyl]-4-methylphenyl]oxamide.
| Compound Name | N'-[3-[4-[[4-(methanesulfonamidomethyl)phenyl]carbamoyl]phenyl]-4-methylphenyl]oxamide |
|---|---|
| PubChem CID | 21090562 |
| Molecular Formula | C24H24N4O5S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N'-[3-[4-[[4-(methanesulfonamidomethyl)phenyl]carbamoyl]phenyl]-4-methylphenyl]oxamide |
| SMILES | Cc1ccc(NC(=O)C(N)=O)cc1-c1ccc(C(=O)Nc2ccc(CNS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C24H24N4O5S/c1-15-3-10-20(28-24(31)22(25)29)13-21(15)17-6-8-18(9-7-17)23(30)27-19-11-4-16(5-12-19)14-26-34(2,32)33/h3-13,26H,14H2,1-2H3,(H2,25,29)(H,27,30)(H,28,31) |
| InChIKey | PECNCRJTLRLAEX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|