C24H21BrN2O2 — CID 21092854
N-(1-benzoyl-6-bromo-2-methyl-3,4-dihydro-2H-quinolin-4-yl)benzamide (PubChem CID 21092854) has the molecular formula C24H21BrN2O2 and a molecular weight of 449.35 g/mol. Its IUPAC name is N-(1-benzoyl-6-bromo-2-methyl-3,4-dihydro-2H-quinolin-4-yl)benzamide.
| Compound Name | N-(1-benzoyl-6-bromo-2-methyl-3,4-dihydro-2H-quinolin-4-yl)benzamide |
|---|---|
| PubChem CID | 21092854 |
| Molecular Formula | C24H21BrN2O2 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-(1-benzoyl-6-bromo-2-methyl-3,4-dihydro-2H-quinolin-4-yl)benzamide |
| SMILES | CC1CC(NC(=O)c2ccccc2)c2cc(Br)ccc2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21BrN2O2/c1-16-14-21(26-23(28)17-8-4-2-5-9-17)20-15-19(25)12-13-22(20)27(16)24(29)18-10-6-3-7-11-18/h2-13,15-16,21H,14H2,1H3,(H,26,28) |
| InChIKey | WXLIXBFIXXDESP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |