C17H16ClN3O3 — CID 21092862
[1-(6-chloropyridine-3-carbonyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamic acid (PubChem CID 21092862) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is [1-(6-chloropyridine-3-carbonyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamic acid.
| Compound Name | [1-(6-chloropyridine-3-carbonyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 21092862 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | [1-(6-chloropyridine-3-carbonyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamic acid |
| SMILES | CC1CC(NC(=O)O)c2ccccc2N1C(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H16ClN3O3/c1-10-8-13(20-17(23)24)12-4-2-3-5-14(12)21(10)16(22)11-6-7-15(18)19-9-11/h2-7,9-10,13,20H,8H2,1H3,(H,23,24) |
| InChIKey | GSAJLQRHPGUIGQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|