C24H22ClN3O3 — CID 87624420
benzyl N-[1-(6-chloropyridine-3-carbonyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate (PubChem CID 87624420) has the molecular formula C24H22ClN3O3 and a molecular weight of 435.91 g/mol. Its IUPAC name is benzyl N-[1-(6-chloropyridine-3-carbonyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate.
| Compound Name | benzyl N-[1-(6-chloropyridine-3-carbonyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate |
|---|---|
| PubChem CID | 87624420 |
| Molecular Formula | C24H22ClN3O3 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | benzyl N-[1-(6-chloropyridine-3-carbonyl)-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate |
| SMILES | CC1CC(NC(=O)OCc2ccccc2)c2ccccc2N1C(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C24H22ClN3O3/c1-16-13-20(27-24(30)31-15-17-7-3-2-4-8-17)19-9-5-6-10-21(19)28(16)23(29)18-11-12-22(25)26-14-18/h2-12,14,16,20H,13,15H2,1H3,(H,27,30) |
| InChIKey | HHJUEAZVCYHLAF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|