About 7-bromo-2-methyl-N,N-dipropylindazol-3-amine
7-bromo-2-methyl-N,N-dipropylindazol-3-amine (PubChem CID 21094617) has the molecular formula C14H20BrN3
and a molecular weight of 310.24 g/mol. Its IUPAC name is 7-bromo-2-methyl-N,N-dipropylindazol-3-amine.
Molecular Properties
| Compound Name | 7-bromo-2-methyl-N,N-dipropylindazol-3-amine |
| PubChem CID | 21094617 |
| Molecular Formula | C14H20BrN3 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 7-bromo-2-methyl-N,N-dipropylindazol-3-amine |
| SMILES | CCCN(CCC)c1c2cccc(Br)c2nn1C |
| InChI | InChI=1S/C14H20BrN3/c1-4-9-18(10-5-2)14-11-7-6-8-12(15)13(11)16-17(14)3/h6-8H,4-5,9-10H2,1-3H3 |
| InChIKey | CYLXJSXWBUADCG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-2-methyl-N,N-dipropylindazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-methyl-N,N-dipropylindazol-3-amine?
The IUPAC name of 7-bromo-2-methyl-N,N-dipropylindazol-3-amine (CID 21094617) is 7-bromo-2-methyl-N,N-dipropylindazol-3-amine.
What is the SMILES notation for 7-bromo-2-methyl-N,N-dipropylindazol-3-amine?
The canonical SMILES for 7-bromo-2-methyl-N,N-dipropylindazol-3-amine is CCCN(CCC)c1c2cccc(Br)c2nn1C.
What is the InChIKey of 7-bromo-2-methyl-N,N-dipropylindazol-3-amine?
The InChIKey is CYLXJSXWBUADCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrN3/c1-4-9-18(10-5-2)14-11-7-6-8-12(15)13(11)16-17(14)3/h6-8H,4-5,9-10H2,1-3H3.
What are the key properties of 7-bromo-2-methyl-N,N-dipropylindazol-3-amine?
7-bromo-2-methyl-N,N-dipropylindazol-3-amine has a molecular weight of 310.24 g/mol, XLogP of 3.96, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-methyl-N,N-dipropylindazol-3-amine is sourced from PubChem (CID 21094617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).