C10H7BrF3N3O — CID 90376641
N-(7-bromo-1-methylindazol-3-yl)-2,2,2-trifluoroacetamide (PubChem CID 90376641) has the molecular formula C10H7BrF3N3O and a molecular weight of 322.08 g/mol. Its IUPAC name is N-(7-bromo-1-methylindazol-3-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(7-bromo-1-methylindazol-3-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 90376641 |
| Molecular Formula | C10H7BrF3N3O |
| Molecular Weight | 322.08 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | N-(7-bromo-1-methylindazol-3-yl)-2,2,2-trifluoroacetamide |
| SMILES | Cn1nc(NC(=O)C(F)(F)F)c2cccc(Br)c21 |
| InChI | InChI=1S/C10H7BrF3N3O/c1-17-7-5(3-2-4-6(7)11)8(16-17)15-9(18)10(12,13)14/h2-4H,1H3,(H,15,16,18) |
| InChIKey | NFPXWZOAFCIFLJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.08 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |