C17H14F2N2O4 — CID 2109757
methyl 4-[[2-(2,5-difluoroanilino)-2-oxoethoxy]iminomethyl]benzoate (PubChem CID 2109757) has the molecular formula C17H14F2N2O4 and a molecular weight of 348.31 g/mol. Its IUPAC name is methyl 4-[[2-(2,5-difluoroanilino)-2-oxoethoxy]iminomethyl]benzoate.
| Compound Name | methyl 4-[[2-(2,5-difluoroanilino)-2-oxoethoxy]iminomethyl]benzoate |
|---|---|
| PubChem CID | 2109757 |
| Molecular Formula | C17H14F2N2O4 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | methyl 4-[[2-(2,5-difluoroanilino)-2-oxoethoxy]iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NOCC(=O)Nc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C17H14F2N2O4/c1-24-17(23)12-4-2-11(3-5-12)9-20-25-10-16(22)21-15-8-13(18)6-7-14(15)19/h2-9H,10H2,1H3,(H,21,22) |
| InChIKey | KFHJVNYTDRBHOC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|