C13H16OSi — CID 21099639
2-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane (PubChem CID 21099639) has the molecular formula C13H16OSi and a molecular weight of 216.36 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane.
| Compound Name | 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane |
|---|---|
| PubChem CID | 21099639 |
| Molecular Formula | C13H16OSi |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane |
| SMILES | C=C[Si](C=C)(C=C)OC1=CC2C=CC1C2 |
| InChI | InChI=1S/C13H16OSi/c1-4-15(5-2,6-3)14-13-10-11-7-8-12(13)9-11/h4-8,10-12H,1-3,9H2 |
| InChIKey | VRDYIRBZFUWYMB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|