C9H12F3N3S — CID 21100172
2-piperazin-1-yl-4-(2,2,2-trifluoroethyl)-1,3-thiazole (PubChem CID 21100172) has the molecular formula C9H12F3N3S and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-piperazin-1-yl-4-(2,2,2-trifluoroethyl)-1,3-thiazole.
| Compound Name | 2-piperazin-1-yl-4-(2,2,2-trifluoroethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 21100172 |
| Molecular Formula | C9H12F3N3S |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-piperazin-1-yl-4-(2,2,2-trifluoroethyl)-1,3-thiazole |
| SMILES | FC(F)(F)Cc1csc(N2CCNCC2)n1 |
| InChI | InChI=1S/C9H12F3N3S/c10-9(11,12)5-7-6-16-8(14-7)15-3-1-13-2-4-15/h6,13H,1-5H2 |
| InChIKey | ISYQYPJZIUEAIS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |