C8H13N3S — CID 14479872
4-methyl-2-piperazin-1-yl-1,3-thiazole (PubChem CID 14479872) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is 4-methyl-2-piperazin-1-yl-1,3-thiazole.
| Compound Name | 4-methyl-2-piperazin-1-yl-1,3-thiazole |
|---|---|
| PubChem CID | 14479872 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 4-methyl-2-piperazin-1-yl-1,3-thiazole |
| SMILES | Cc1csc(N2CCNCC2)n1 |
| InChI | InChI=1S/C8H13N3S/c1-7-6-12-8(10-7)11-4-2-9-3-5-11/h6,9H,2-5H2,1H3 |
| InChIKey | UGWOIKOTDJQPST-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |