C7H11N3S2 — CID 3613328
1,1-dimethyl-3-(4-methyl-1,3-thiazol-2-yl)thiourea (PubChem CID 3613328) has the molecular formula C7H11N3S2 and a molecular weight of 201.32 g/mol. Its IUPAC name is 1,1-dimethyl-3-(4-methyl-1,3-thiazol-2-yl)thiourea.
| Compound Name | 1,1-dimethyl-3-(4-methyl-1,3-thiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 3613328 |
| Molecular Formula | C7H11N3S2 |
| Molecular Weight | 201.32 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 1,1-dimethyl-3-(4-methyl-1,3-thiazol-2-yl)thiourea |
| SMILES | Cc1csc(NC(=S)N(C)C)n1 |
| InChI | InChI=1S/C7H11N3S2/c1-5-4-12-6(8-5)9-7(11)10(2)3/h4H,1-3H3,(H,8,9,11) |
| InChIKey | FIGRRRXEUUOHRS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|