C17H17FN4O2 — CID 21101134
N-(3-aminopropyl)-3-fluoro-4-(4-hydroxy-1H-benzimidazol-2-yl)benzamide (PubChem CID 21101134) has the molecular formula C17H17FN4O2 and a molecular weight of 328.35 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-fluoro-4-(4-hydroxy-1H-benzimidazol-2-yl)benzamide.
| Compound Name | N-(3-aminopropyl)-3-fluoro-4-(4-hydroxy-1H-benzimidazol-2-yl)benzamide |
|---|---|
| PubChem CID | 21101134 |
| Molecular Formula | C17H17FN4O2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N-(3-aminopropyl)-3-fluoro-4-(4-hydroxy-1H-benzimidazol-2-yl)benzamide |
| SMILES | NCCCNC(=O)c1ccc(-c2nc3c(O)cccc3[nH]2)c(F)c1 |
| InChI | InChI=1S/C17H17FN4O2/c18-12-9-10(17(24)20-8-2-7-19)5-6-11(12)16-21-13-3-1-4-14(23)15(13)22-16/h1,3-6,9,23H,2,7-8,19H2,(H,20,24)(H,21,22) |
| InChIKey | IEXFGNBPDMAYKU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|