C24H23NO5 — CID 21101220
2-[2-methoxy-3-[(E)-3-[2-(4-methylbenzoyl)pyrrol-1-yl]prop-1-enyl]phenoxy]acetic acid (PubChem CID 21101220) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-[2-methoxy-3-[(E)-3-[2-(4-methylbenzoyl)pyrrol-1-yl]prop-1-enyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methoxy-3-[(E)-3-[2-(4-methylbenzoyl)pyrrol-1-yl]prop-1-enyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 21101220 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-[2-methoxy-3-[(E)-3-[2-(4-methylbenzoyl)pyrrol-1-yl]prop-1-enyl]phenoxy]acetic acid |
| SMILES | COc1c(/C=C/Cn2cccc2C(=O)c2ccc(C)cc2)cccc1OCC(=O)O |
| InChI | InChI=1S/C24H23NO5/c1-17-10-12-18(13-11-17)23(28)20-8-5-15-25(20)14-4-7-19-6-3-9-21(24(19)29-2)30-16-22(26)27/h3-13,15H,14,16H2,1-2H3,(H,26,27)/b7-4+ |
| InChIKey | MFRTVJNAMKGXAP-QPJJXVBHSA-N |
| XLogP | 4.21 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |